C10H11ClN6O — CID 110874649
1-(3-chlorophenyl)-3-[(1-methyltetrazol-5-yl)methyl]urea (PubChem CID 110874649) has the molecular formula C10H11ClN6O and a molecular weight of 266.69 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1-methyltetrazol-5-yl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1-methyltetrazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 110874649 |
| Molecular Formula | C10H11ClN6O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1-methyltetrazol-5-yl)methyl]urea |
| SMILES | Cn1nnnc1CNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H11ClN6O/c1-17-9(14-15-16-17)6-12-10(18)13-8-4-2-3-7(11)5-8/h2-5H,6H2,1H3,(H2,12,13,18) |
| InChIKey | PPTURBPVKLBDOI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |