C13H15ClN4O — CID 19326785
1-(3-chlorophenyl)-3-[(1-ethylpyrazol-4-yl)methyl]urea (PubChem CID 19326785) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1-ethylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1-ethylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 19326785 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1-ethylpyrazol-4-yl)methyl]urea |
| SMILES | CCn1cc(CNC(=O)Nc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C13H15ClN4O/c1-2-18-9-10(8-16-18)7-15-13(19)17-12-5-3-4-11(14)6-12/h3-6,8-9H,2,7H2,1H3,(H2,15,17,19) |
| InChIKey | GSHVMIKOIDVEQZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |