C19H25N5O4 — CID 72929033
1-[(1-ethylpyrazol-4-yl)methyl]-3-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]urea (PubChem CID 72929033) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[(1-ethylpyrazol-4-yl)methyl]-3-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]urea.
| Compound Name | 1-[(1-ethylpyrazol-4-yl)methyl]-3-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]urea |
|---|---|
| PubChem CID | 72929033 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[(1-ethylpyrazol-4-yl)methyl]-3-[3-(2-morpholin-4-yl-2-oxoethoxy)phenyl]urea |
| SMILES | CCn1cc(CNC(=O)Nc2cccc(OCC(=O)N3CCOCC3)c2)cn1 |
| InChI | InChI=1S/C19H25N5O4/c1-2-24-13-15(12-21-24)11-20-19(26)22-16-4-3-5-17(10-16)28-14-18(25)23-6-8-27-9-7-23/h3-5,10,12-13H,2,6-9,11,14H2,1H3,(H2,20,22,26) |
| InChIKey | PSNBEEYEQQZFSC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |