C14H19N5O3S — CID 53499866
1-(1-ethylpyrazol-4-yl)-3-[[3-(methylsulfamoyl)phenyl]methyl]urea (PubChem CID 53499866) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)-3-[[3-(methylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-(1-ethylpyrazol-4-yl)-3-[[3-(methylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 53499866 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)-3-[[3-(methylsulfamoyl)phenyl]methyl]urea |
| SMILES | CCn1cc(NC(=O)NCc2cccc(S(=O)(=O)NC)c2)cn1 |
| InChI | InChI=1S/C14H19N5O3S/c1-3-19-10-12(9-17-19)18-14(20)16-8-11-5-4-6-13(7-11)23(21,22)15-2/h4-7,9-10,15H,3,8H2,1-2H3,(H2,16,18,20) |
| InChIKey | MDDAQWVWPZYAKI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |