C18H17BrN4O3S — CID 55851572
1-(4-bromophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrazole-4-carboxamide (PubChem CID 55851572) has the molecular formula C18H17BrN4O3S and a molecular weight of 449.33 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55851572 |
| Molecular Formula | C18H17BrN4O3S |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 1-(4-bromophenyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrazole-4-carboxamide |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)c2cnn(-c3ccc(Br)cc3)c2)c1 |
| InChI | InChI=1S/C18H17BrN4O3S/c1-20-27(25,26)17-4-2-3-13(9-17)10-21-18(24)14-11-22-23(12-14)16-7-5-15(19)6-8-16/h2-9,11-12,20H,10H2,1H3,(H,21,24) |
| InChIKey | RMRWDMDQGWCBNH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |