C15H16N4OS — CID 11855263
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 11855263) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 11855263 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NCCNc1nsc2ccccc12 |
| InChI | InChI=1S/C15H16N4OS/c1-19-10-4-6-12(19)15(20)17-9-8-16-14-11-5-2-3-7-13(11)21-18-14/h2-7,10H,8-9H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | GEZJVVPHZYGQMV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|