C16H16N4OS — CID 11855264
N-[3-(1,2-benzothiazol-3-ylamino)propyl]pyridine-2-carboxamide (PubChem CID 11855264) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]pyridine-2-carboxamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11855264 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCCNc1nsc2ccccc12)c1ccccn1 |
| InChI | InChI=1S/C16H16N4OS/c21-16(13-7-3-4-9-17-13)19-11-5-10-18-15-12-6-1-2-8-14(12)22-20-15/h1-4,6-9H,5,10-11H2,(H,18,20)(H,19,21) |
| InChIKey | ZDDNBLIAMHFCNP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|