C15H16N4S — CID 58726811
N'-(1,2-benzothiazol-3-yl)-N-(pyridin-2-ylmethyl)ethane-1,2-diamine (PubChem CID 58726811) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is N'-(1,2-benzothiazol-3-yl)-N-(pyridin-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(1,2-benzothiazol-3-yl)-N-(pyridin-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 58726811 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N'-(1,2-benzothiazol-3-yl)-N-(pyridin-2-ylmethyl)ethane-1,2-diamine |
| SMILES | c1ccc(CNCCNc2nsc3ccccc23)nc1 |
| InChI | InChI=1S/C15H16N4S/c1-2-7-14-13(6-1)15(19-20-14)18-10-9-16-11-12-5-3-4-8-17-12/h1-8,16H,9-11H2,(H,18,19) |
| InChIKey | ZMKQUSMXQHVDOY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|