C16H15N5S — CID 57436385
6-[3-(1,2-benzothiazol-3-ylamino)propylamino]pyridine-3-carbonitrile (PubChem CID 57436385) has the molecular formula C16H15N5S and a molecular weight of 309.40 g/mol. Its IUPAC name is 6-[3-(1,2-benzothiazol-3-ylamino)propylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[3-(1,2-benzothiazol-3-ylamino)propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 57436385 |
| Molecular Formula | C16H15N5S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-[3-(1,2-benzothiazol-3-ylamino)propylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCCNc2nsc3ccccc23)nc1 |
| InChI | InChI=1S/C16H15N5S/c17-10-12-6-7-15(20-11-12)18-8-3-9-19-16-13-4-1-2-5-14(13)22-21-16/h1-2,4-7,11H,3,8-9H2,(H,18,20)(H,19,21) |
| InChIKey | FOFNPSOPUCHFIT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|