C21H21N5O2S — CID 57436494
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 57436494) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 57436494 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCNc3nsc4ccccc34)[nH]n2)cc1 |
| InChI | InChI=1S/C21H21N5O2S/c1-28-15-9-7-14(8-10-15)17-13-18(25-24-17)21(27)23-12-4-11-22-20-16-5-2-3-6-19(16)29-26-20/h2-3,5-10,13H,4,11-12H2,1H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | HALBREYHLZYEKZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|