C24H24N4O4S2 — CID 58727007
4-(4-methoxyphenyl)-N-[3-[(6-sulfamoyl-1,2-benzothiazol-3-yl)amino]propyl]benzamide (PubChem CID 58727007) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[3-[(6-sulfamoyl-1,2-benzothiazol-3-yl)amino]propyl]benzamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[3-[(6-sulfamoyl-1,2-benzothiazol-3-yl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 58727007 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[3-[(6-sulfamoyl-1,2-benzothiazol-3-yl)amino]propyl]benzamide |
| SMILES | COc1ccc(-c2ccc(C(=O)NCCCNc3nsc4cc(S(N)(=O)=O)ccc34)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-32-19-9-7-17(8-10-19)16-3-5-18(6-4-16)24(29)27-14-2-13-26-23-21-12-11-20(34(25,30)31)15-22(21)33-28-23/h3-12,15H,2,13-14H2,1H3,(H,26,28)(H,27,29)(H2,25,30,31) |
| InChIKey | XMSXLRFZNYSJNL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|