C25H24F3N3OS — CID 58727227
N-[[4-(4-methoxyphenyl)phenyl]methyl]-N'-[6-(trifluoromethyl)-1,2-benzothiazol-3-yl]propane-1,3-diamine (PubChem CID 58727227) has the molecular formula C25H24F3N3OS and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)phenyl]methyl]-N'-[6-(trifluoromethyl)-1,2-benzothiazol-3-yl]propane-1,3-diamine.
| Compound Name | N-[[4-(4-methoxyphenyl)phenyl]methyl]-N'-[6-(trifluoromethyl)-1,2-benzothiazol-3-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58727227 |
| Molecular Formula | C25H24F3N3OS |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)phenyl]methyl]-N'-[6-(trifluoromethyl)-1,2-benzothiazol-3-yl]propane-1,3-diamine |
| SMILES | COc1ccc(-c2ccc(CNCCCNc3nsc4cc(C(F)(F)F)ccc34)cc2)cc1 |
| InChI | InChI=1S/C25H24F3N3OS/c1-32-21-10-7-19(8-11-21)18-5-3-17(4-6-18)16-29-13-2-14-30-24-22-12-9-20(25(26,27)28)15-23(22)33-31-24/h3-12,15,29H,2,13-14,16H2,1H3,(H,30,31) |
| InChIKey | BLXJWVCKDBZPIZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|