C24H18BrF3N2O — CID 156785628
7-bromo-N-[(4-methoxyphenyl)methyl]-4-[4-(trifluoromethyl)phenyl]isoquinolin-1-amine (PubChem CID 156785628) has the molecular formula C24H18BrF3N2O and a molecular weight of 487.32 g/mol. Its IUPAC name is 7-bromo-N-[(4-methoxyphenyl)methyl]-4-[4-(trifluoromethyl)phenyl]isoquinolin-1-amine.
| Compound Name | 7-bromo-N-[(4-methoxyphenyl)methyl]-4-[4-(trifluoromethyl)phenyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 156785628 |
| Molecular Formula | C24H18BrF3N2O |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 7-bromo-N-[(4-methoxyphenyl)methyl]-4-[4-(trifluoromethyl)phenyl]isoquinolin-1-amine |
| SMILES | COc1ccc(CNc2ncc(-c3ccc(C(F)(F)F)cc3)c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C24H18BrF3N2O/c1-31-19-9-2-15(3-10-19)13-29-23-21-12-18(25)8-11-20(21)22(14-30-23)16-4-6-17(7-5-16)24(26,27)28/h2-12,14H,13H2,1H3,(H,29,30) |
| InChIKey | VOAVEIGLLSVGMP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |