C31H31N3O2S — CID 58727091
N'-[5-(4-methoxyphenyl)-1,2-benzothiazol-3-yl]-N-[[4-(4-methoxyphenyl)phenyl]methyl]propane-1,3-diamine (PubChem CID 58727091) has the molecular formula C31H31N3O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is N'-[5-(4-methoxyphenyl)-1,2-benzothiazol-3-yl]-N-[[4-(4-methoxyphenyl)phenyl]methyl]propane-1,3-diamine.
| Compound Name | N'-[5-(4-methoxyphenyl)-1,2-benzothiazol-3-yl]-N-[[4-(4-methoxyphenyl)phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58727091 |
| Molecular Formula | C31H31N3O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N'-[5-(4-methoxyphenyl)-1,2-benzothiazol-3-yl]-N-[[4-(4-methoxyphenyl)phenyl]methyl]propane-1,3-diamine |
| SMILES | COc1ccc(-c2ccc(CNCCCNc3nsc4ccc(-c5ccc(OC)cc5)cc34)cc2)cc1 |
| InChI | InChI=1S/C31H31N3O2S/c1-35-27-13-8-24(9-14-27)23-6-4-22(5-7-23)21-32-18-3-19-33-31-29-20-26(12-17-30(29)37-34-31)25-10-15-28(36-2)16-11-25/h4-17,20,32H,3,18-19,21H2,1-2H3,(H,33,34) |
| InChIKey | MVLSYDFKEDBBHJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|