C23H23N3O3S2 — CID 58727038
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-4-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 58727038) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-4-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-4-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58727038 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-4-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)NCCCNc3nsc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O3S2/c1-29-19-11-7-17(8-12-19)18-9-13-20(14-10-18)31(27,28)25-16-4-15-24-23-21-5-2-3-6-22(21)30-26-23/h2-3,5-14,25H,4,15-16H2,1H3,(H,24,26) |
| InChIKey | YHOBEQKXAHNRGM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|