C20H24N4O4S2 — CID 59362047
4-methoxy-N-[3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]benzenesulfonamide (PubChem CID 59362047) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-methoxy-N-[3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59362047 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4-methoxy-N-[3-[[3-[(3-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCNc2nc(Cc3cccc(OC)c3)ns2)cc1 |
| InChI | InChI=1S/C20H24N4O4S2/c1-27-16-7-9-18(10-8-16)30(25,26)22-12-4-11-21-20-23-19(24-29-20)14-15-5-3-6-17(13-15)28-2/h3,5-10,13,22H,4,11-12,14H2,1-2H3,(H,21,23,24) |
| InChIKey | MCTMBDVSXHJXJP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|