C17H19FN4O2S3 — CID 66878841
N-[3-[[3-[(4-fluoro-3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]thiophene-2-sulfonamide (PubChem CID 66878841) has the molecular formula C17H19FN4O2S3 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[3-[[3-[(4-fluoro-3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[[3-[(4-fluoro-3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66878841 |
| Molecular Formula | C17H19FN4O2S3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-[3-[[3-[(4-fluoro-3-methylphenyl)methyl]-1,2,4-thiadiazol-5-yl]amino]propyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(Cc2nsc(NCCCNS(=O)(=O)c3cccs3)n2)ccc1F |
| InChI | InChI=1S/C17H19FN4O2S3/c1-12-10-13(5-6-14(12)18)11-15-21-17(26-22-15)19-7-3-8-20-27(23,24)16-4-2-9-25-16/h2,4-6,9-10,20H,3,7-8,11H2,1H3,(H,19,21,22) |
| InChIKey | AACKUQSTEFSHEK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|