C23H20ClN3O2S — CID 58727173
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-chloro-2-methoxyphenyl)benzamide (PubChem CID 58727173) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-chloro-2-methoxyphenyl)benzamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-chloro-2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 58727173 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-chloro-2-methoxyphenyl)benzamide |
| SMILES | COc1ccc(Cl)cc1-c1ccc(C(=O)NCCNc2nsc3ccccc23)cc1 |
| InChI | InChI=1S/C23H20ClN3O2S/c1-29-20-11-10-17(24)14-19(20)15-6-8-16(9-7-15)23(28)26-13-12-25-22-18-4-2-3-5-21(18)30-27-22/h2-11,14H,12-13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | GJMFGQBBKKMWIG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|