C27H30N4O2S — CID 58727322
1-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-[4-(5-methyl-2-propan-2-yloxyphenyl)phenyl]urea (PubChem CID 58727322) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is 1-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-[4-(5-methyl-2-propan-2-yloxyphenyl)phenyl]urea.
| Compound Name | 1-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-[4-(5-methyl-2-propan-2-yloxyphenyl)phenyl]urea |
|---|---|
| PubChem CID | 58727322 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-[4-(5-methyl-2-propan-2-yloxyphenyl)phenyl]urea |
| SMILES | Cc1ccc(OC(C)C)c(-c2ccc(NC(=O)NCCCNc3nsc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C27H30N4O2S/c1-18(2)33-24-14-9-19(3)17-23(24)20-10-12-21(13-11-20)30-27(32)29-16-6-15-28-26-22-7-4-5-8-25(22)34-31-26/h4-5,7-14,17-18H,6,15-16H2,1-3H3,(H,28,31)(H2,29,30,32) |
| InChIKey | LPXLHSWMXMSFEL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|