C23H25N5O3S — CID 58727289
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(propylcarbamoylamino)-1-benzofuran-2-carboxamide (PubChem CID 58727289) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(propylcarbamoylamino)-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(propylcarbamoylamino)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 58727289 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(propylcarbamoylamino)-1-benzofuran-2-carboxamide |
| SMILES | CCCNC(=O)Nc1ccc2oc(C(=O)NCCCNc3nsc4ccccc34)cc2c1 |
| InChI | InChI=1S/C23H25N5O3S/c1-2-10-26-23(30)27-16-8-9-18-15(13-16)14-19(31-18)22(29)25-12-5-11-24-21-17-6-3-4-7-20(17)32-28-21/h3-4,6-9,13-14H,2,5,10-12H2,1H3,(H,24,28)(H,25,29)(H2,26,27,30) |
| InChIKey | TUOYWZHDSIDGPO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|