C22H19ClN4OS — CID 57436459
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(6-chloro-3-pyridinyl)benzamide (PubChem CID 57436459) has the molecular formula C22H19ClN4OS and a molecular weight of 422.94 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(6-chloro-3-pyridinyl)benzamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(6-chloro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 57436459 |
| Molecular Formula | C22H19ClN4OS |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-3-(6-chloro-3-pyridinyl)benzamide |
| SMILES | O=C(NCCCNc1nsc2ccccc12)c1cccc(-c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C22H19ClN4OS/c23-20-10-9-17(14-26-20)15-5-3-6-16(13-15)22(28)25-12-4-11-24-21-18-7-1-2-8-19(18)29-27-21/h1-3,5-10,13-14H,4,11-12H2,(H,24,27)(H,25,28) |
| InChIKey | FDLMXGXGHMDCQC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|