C16H14N6OS — CID 11856620
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 11856620) has the molecular formula C16H14N6OS and a molecular weight of 338.40 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 11856620 |
| Molecular Formula | C16H14N6OS |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(NCCNc1nsc2ccccc12)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C16H14N6OS/c23-16(10-5-6-12-13(9-10)20-22-19-12)18-8-7-17-15-11-3-1-2-4-14(11)24-21-15/h1-6,9H,7-8H2,(H,17,21)(H,18,23)(H,19,20,22) |
| InChIKey | XNOHFBLXCPILAK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|