C20H19N5O2S — CID 91103732
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-methyl-3-oxo-1H-pyrazol-2-yl)benzamide (PubChem CID 91103732) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-methyl-3-oxo-1H-pyrazol-2-yl)benzamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-methyl-3-oxo-1H-pyrazol-2-yl)benzamide |
|---|---|
| PubChem CID | 91103732 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-4-(5-methyl-3-oxo-1H-pyrazol-2-yl)benzamide |
| SMILES | Cc1cc(=O)n(-c2ccc(C(=O)NCCNc3nsc4ccccc34)cc2)[nH]1 |
| InChI | InChI=1S/C20H19N5O2S/c1-13-12-18(26)25(23-13)15-8-6-14(7-9-15)20(27)22-11-10-21-19-16-4-2-3-5-17(16)28-24-19/h2-9,12,23H,10-11H2,1H3,(H,21,24)(H,22,27) |
| InChIKey | HIMCNHCBFOKGHA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|