C16H13F2N3OS — CID 57436445
N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2,5-difluorobenzamide (PubChem CID 57436445) has the molecular formula C16H13F2N3OS and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2,5-difluorobenzamide.
| Compound Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 57436445 |
| Molecular Formula | C16H13F2N3OS |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-ylamino)ethyl]-2,5-difluorobenzamide |
| SMILES | O=C(NCCNc1nsc2ccccc12)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2N3OS/c17-10-5-6-13(18)12(9-10)16(22)20-8-7-19-15-11-3-1-2-4-14(11)23-21-15/h1-6,9H,7-8H2,(H,19,21)(H,20,22) |
| InChIKey | NNRWPTPRPYXSHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|