C27H32N4O3S — CID 57436552
tert-butyl 4-[3-[3-(1,2-benzothiazol-3-ylamino)propylcarbamoyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 57436552) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-(1,2-benzothiazol-3-ylamino)propylcarbamoyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-(1,2-benzothiazol-3-ylamino)propylcarbamoyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 57436552 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | tert-butyl 4-[3-[3-(1,2-benzothiazol-3-ylamino)propylcarbamoyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cccc(C(=O)NCCCNc3nsc4ccccc34)c2)CC1 |
| InChI | InChI=1S/C27H32N4O3S/c1-27(2,3)34-26(33)31-16-12-19(13-17-31)20-8-6-9-21(18-20)25(32)29-15-7-14-28-24-22-10-4-5-11-23(22)35-30-24/h4-6,8-12,18H,7,13-17H2,1-3H3,(H,28,30)(H,29,32) |
| InChIKey | YXZSKJKIHDXUSO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|