C20H30N4O2S — CID 58727150
tert-butyl 4-[3-(1,2-benzothiazol-3-ylamino)propylamino]piperidine-1-carboxylate (PubChem CID 58727150) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is tert-butyl 4-[3-(1,2-benzothiazol-3-ylamino)propylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(1,2-benzothiazol-3-ylamino)propylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58727150 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | tert-butyl 4-[3-(1,2-benzothiazol-3-ylamino)propylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCCCNc2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C20H30N4O2S/c1-20(2,3)26-19(25)24-13-9-15(10-14-24)21-11-6-12-22-18-16-7-4-5-8-17(16)27-23-18/h4-5,7-8,15,21H,6,9-14H2,1-3H3,(H,22,23) |
| InChIKey | XFMFTVYPTQTSPQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|