C23H24N6OS — CID 58727179
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-6-(2-pyridin-3-ylethylamino)pyridine-2-carboxamide (PubChem CID 58727179) has the molecular formula C23H24N6OS and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-6-(2-pyridin-3-ylethylamino)pyridine-2-carboxamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-6-(2-pyridin-3-ylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58727179 |
| Molecular Formula | C23H24N6OS |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-6-(2-pyridin-3-ylethylamino)pyridine-2-carboxamide |
| SMILES | O=C(NCCCNc1nsc2ccccc12)c1cccc(NCCc2cccnc2)n1 |
| InChI | InChI=1S/C23H24N6OS/c30-23(27-14-5-13-26-22-18-7-1-2-9-20(18)31-29-22)19-8-3-10-21(28-19)25-15-11-17-6-4-12-24-16-17/h1-4,6-10,12,16H,5,11,13-15H2,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | NNANSXPUJRSXLU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|