C15H17ClN4O — CID 86779907
6-chloro-N-[3-(pyridin-3-ylmethylamino)propyl]pyridine-2-carboxamide (PubChem CID 86779907) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 6-chloro-N-[3-(pyridin-3-ylmethylamino)propyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[3-(pyridin-3-ylmethylamino)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86779907 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 6-chloro-N-[3-(pyridin-3-ylmethylamino)propyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCCNCc1cccnc1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C15H17ClN4O/c16-14-6-1-5-13(20-14)15(21)19-9-3-8-18-11-12-4-2-7-17-10-12/h1-2,4-7,10,18H,3,8-9,11H2,(H,19,21) |
| InChIKey | WTKZHOIYIDXQOA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|