C14H18N4O2 — CID 66335871
4-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,2-oxazole-5-carboxamide (PubChem CID 66335871) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 66335871 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)NCCCNCc1cccnc1 |
| InChI | InChI=1S/C14H18N4O2/c1-11-8-18-20-13(11)14(19)17-7-3-6-16-10-12-4-2-5-15-9-12/h2,4-5,8-9,16H,3,6-7,10H2,1H3,(H,17,19) |
| InChIKey | ARXNIYFUBDKYBW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|