C13H17N5O2 — CID 43600464
2-oxo-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-dihydroimidazole-4-carboxamide (PubChem CID 43600464) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-oxo-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | 2-oxo-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 43600464 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-oxo-N-[3-(pyridin-3-ylmethylamino)propyl]-1,3-dihydroimidazole-4-carboxamide |
| SMILES | O=C(NCCCNCc1cccnc1)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H17N5O2/c19-12(11-9-17-13(20)18-11)16-6-2-5-15-8-10-3-1-4-14-7-10/h1,3-4,7,9,15H,2,5-6,8H2,(H,16,19)(H2,17,18,20) |
| InChIKey | QVRSZXLEPJFQOS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|