C8H14N4O2 — CID 43600591
N-[3-(methylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 43600591) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N-[3-(methylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 43600591 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | CNCCCNC(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H14N4O2/c1-9-3-2-4-10-7(13)6-5-11-8(14)12-6/h5,9H,2-4H2,1H3,(H,10,13)(H2,11,12,14) |
| InChIKey | MVOXOLZLYDIIGN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|