C15H20ClN3O — CID 119431690
N-[3-(methylamino)propyl]-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 119431690) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119431690 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[3-(methylamino)propyl]-5-phenyl-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1ccc(-c2ccccc2)[nH]1.Cl |
| InChI | InChI=1S/C15H19N3O.ClH/c1-16-10-5-11-17-15(19)14-9-8-13(18-14)12-6-3-2-4-7-12;/h2-4,6-9,16,18H,5,10-11H2,1H3,(H,17,19);1H |
| InChIKey | LIYBEIQDEMNYHB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|