C22H18N2O3 — CID 139189346
1,2-bis(5-phenyl-1H-pyrrol-2-yl)ethane-1,2-dione;hydrate (PubChem CID 139189346) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1,2-bis(5-phenyl-1H-pyrrol-2-yl)ethane-1,2-dione;hydrate.
| Compound Name | 1,2-bis(5-phenyl-1H-pyrrol-2-yl)ethane-1,2-dione;hydrate |
|---|---|
| PubChem CID | 139189346 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1,2-bis(5-phenyl-1H-pyrrol-2-yl)ethane-1,2-dione;hydrate |
| SMILES | O.O=C(C(=O)c1ccc(-c2ccccc2)[nH]1)c1ccc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H16N2O2.H2O/c25-21(19-13-11-17(23-19)15-7-3-1-4-8-15)22(26)20-14-12-18(24-20)16-9-5-2-6-10-16;/h1-14,23-24H;1H2 |
| InChIKey | FAGYDQOQGJJYMM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|