C27H26N2O2 — CID 102478566
1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-(5-phenyl-1H-pyrrol-2-yl)propane-1,3-dione (PubChem CID 102478566) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-(5-phenyl-1H-pyrrol-2-yl)propane-1,3-dione.
| Compound Name | 1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-(5-phenyl-1H-pyrrol-2-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 102478566 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-(5-phenyl-1H-pyrrol-2-yl)propane-1,3-dione |
| SMILES | CCc1c(C(=O)CC(=O)c2ccc(-c3ccccc3)[nH]2)[nH]c(-c2ccccc2)c1CC |
| InChI | InChI=1S/C27H26N2O2/c1-3-20-21(4-2)27(29-26(20)19-13-9-6-10-14-19)25(31)17-24(30)23-16-15-22(28-23)18-11-7-5-8-12-18/h5-16,28-29H,3-4,17H2,1-2H3 |
| InChIKey | NVKHJBSDRAHQRU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|