C14H14INO2 — CID 135385489
methyl 3-ethyl-4-iodo-5-phenyl-1H-pyrrole-2-carboxylate (PubChem CID 135385489) has the molecular formula C14H14INO2 and a molecular weight of 355.18 g/mol. Its IUPAC name is methyl 3-ethyl-4-iodo-5-phenyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 3-ethyl-4-iodo-5-phenyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135385489 |
| Molecular Formula | C14H14INO2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | methyl 3-ethyl-4-iodo-5-phenyl-1H-pyrrole-2-carboxylate |
| SMILES | CCc1c(C(=O)OC)[nH]c(-c2ccccc2)c1I |
| InChI | InChI=1S/C14H14INO2/c1-3-10-11(15)12(9-7-5-4-6-8-9)16-13(10)14(17)18-2/h4-8,16H,3H2,1-2H3 |
| InChIKey | KEHGOXVXLPJNEC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|