C31H34N2O2 — CID 102046433
(Z)-1,3-bis(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-hydroxyprop-2-en-1-one (PubChem CID 102046433) has the molecular formula C31H34N2O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is (Z)-1,3-bis(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-hydroxyprop-2-en-1-one.
| Compound Name | (Z)-1,3-bis(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 102046433 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (Z)-1,3-bis(3,4-diethyl-5-phenyl-1H-pyrrol-2-yl)-3-hydroxyprop-2-en-1-one |
| SMILES | CCc1c(C(=O)/C=C(\O)c2[nH]c(-c3ccccc3)c(CC)c2CC)[nH]c(-c2ccccc2)c1CC |
| InChI | InChI=1S/C31H34N2O2/c1-5-22-24(7-3)30(32-28(22)20-15-11-9-12-16-20)26(34)19-27(35)31-25(8-4)23(6-2)29(33-31)21-17-13-10-14-18-21/h9-19,32-34H,5-8H2,1-4H3/b26-19- |
| InChIKey | HPHJEMPDTZVTEK-XHPQRKPJSA-N |
| XLogP | 7.71 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|