C52H48N4 — CID 101041743
(5Z,9Z,15Z,19Z)-2,3,12,13-tetraethyl-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 101041743) has the molecular formula C52H48N4 and a molecular weight of 728.98 g/mol. Its IUPAC name is (5Z,9Z,15Z,19Z)-2,3,12,13-tetraethyl-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | (5Z,9Z,15Z,19Z)-2,3,12,13-tetraethyl-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 101041743 |
| Molecular Formula | C52H48N4 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.39 |
| IUPAC Name | (5Z,9Z,15Z,19Z)-2,3,12,13-tetraethyl-5,10,15,20-tetraphenyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCc1c2[nH]c(c1CC)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1[nH]c(c(CC)c1CC)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C52H48N4/c1-5-37-38(6-2)50-46(34-23-15-10-16-24-34)42-31-32-44(54-42)48(36-27-19-12-20-28-36)52-40(8-4)39(7-3)51(56-52)47(35-25-17-11-18-26-35)43-30-29-41(53-43)45(49(37)55-50)33-21-13-9-14-22-33/h9-32,53-56H,5-8H2,1-4H3/b45-41-,46-42-,47-43-,48-44-,49-45-,50-46-,51-47-,52-48- |
| InChIKey | TUIPGVXQSBHUFR-VIJQYTMKSA-N |
| XLogP | 8.55 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |