C56H72N4 — CID 10653167
(19Z)-5,15-dibutyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenyl-5,15,21,22-tetrahydroporphyrin (PubChem CID 10653167) has the molecular formula C56H72N4 and a molecular weight of 801.22 g/mol. Its IUPAC name is (19Z)-5,15-dibutyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenyl-5,15,21,22-tetrahydroporphyrin.
| Compound Name | (19Z)-5,15-dibutyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenyl-5,15,21,22-tetrahydroporphyrin |
|---|---|
| PubChem CID | 10653167 |
| Molecular Formula | C56H72N4 |
| Molecular Weight | 801.22 g/mol |
| Exact Mass | 800.58 |
| IUPAC Name | (19Z)-5,15-dibutyl-2,3,7,8,12,13,17,18-octaethyl-10,20-diphenyl-5,15,21,22-tetrahydroporphyrin |
| SMILES | CCCCC1C2=NC(=C(c3ccccc3)c3[nH]c(c(CC)c3CC)C(CCCC)c3[nH]c(c(CC)c3CC)/C(c3ccccc3)=C3\N=C1C(CC)=C3CC)C(CC)=C2CC |
| InChI | InChI=1S/C56H72N4/c1-11-21-33-45-49-37(13-3)41(17-7)53(57-49)47(35-29-25-23-26-30-35)55-43(19-9)39(15-5)51(59-55)46(34-22-12-2)52-40(16-6)44(20-10)56(60-52)48(36-31-27-24-28-32-36)54-42(18-8)38(14-4)50(45)58-54/h23-32,45-46,57-58H,11-22,33-34H2,1-10H3/b55-47-,56-48? |
| InChIKey | YROMHUFZXAIOMQ-BUMBUCKESA-N |
| XLogP | 15.40 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.22 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |