C58H66N4 — CID 10795735
15-butyl-2,3,7,8,12,13,17,18-octaethyl-5,10,20-triphenyl-21,22-dihydroporphyrin (PubChem CID 10795735) has the molecular formula C58H66N4 and a molecular weight of 819.19 g/mol. Its IUPAC name is 15-butyl-2,3,7,8,12,13,17,18-octaethyl-5,10,20-triphenyl-21,22-dihydroporphyrin.
| Compound Name | 15-butyl-2,3,7,8,12,13,17,18-octaethyl-5,10,20-triphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10795735 |
| Molecular Formula | C58H66N4 |
| Molecular Weight | 819.19 g/mol |
| Exact Mass | 818.53 |
| IUPAC Name | 15-butyl-2,3,7,8,12,13,17,18-octaethyl-5,10,20-triphenyl-21,22-dihydroporphyrin |
| SMILES | CCCCc1c2nc(c(-c3ccccc3)c3[nH]c(c(CC)c3CC)c(-c3ccccc3)c3[nH]c(c(CC)c3CC)c(-c3ccccc3)c3nc1C(CC)=C3CC)C(CC)=C2CC |
| InChI | InChI=1S/C58H66N4/c1-10-19-35-47-51-39(11-2)41(13-4)53(59-51)48(36-29-23-20-24-30-36)55-43(15-6)45(17-8)57(61-55)50(38-33-27-22-28-34-38)58-46(18-9)44(16-7)56(62-58)49(37-31-25-21-26-32-37)54-42(14-5)40(12-3)52(47)60-54/h20-34,61-62H,10-19,35H2,1-9H3/b51-47-,52-47-,53-48-,54-49-,55-48-,56-49-,57-50-,58-50- |
| InChIKey | IIOQVPZCGREZSF-QMVLINLISA-N |
| XLogP | 16.37 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.19 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |