C60H54Cl8N4 — CID 136792019
5,10,15,20-tetrakis(2,6-dichlorophenyl)-2,3,7,8,12,13,17,18-octaethyl-21,23-dihydroporphyrin (PubChem CID 136792019) has the molecular formula C60H54Cl8N4 and a molecular weight of 1114.74 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,6-dichlorophenyl)-2,3,7,8,12,13,17,18-octaethyl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,6-dichlorophenyl)-2,3,7,8,12,13,17,18-octaethyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136792019 |
| Molecular Formula | C60H54Cl8N4 |
| Molecular Weight | 1114.74 g/mol |
| Exact Mass | 1110.19 |
| IUPAC Name | 5,10,15,20-tetrakis(2,6-dichlorophenyl)-2,3,7,8,12,13,17,18-octaethyl-21,23-dihydroporphyrin |
| SMILES | CCC1=C(CC)c2nc1c(-c1c(Cl)cccc1Cl)c1[nH]c(c(CC)c1CC)c(-c1c(Cl)cccc1Cl)c1nc(c(-c3c(Cl)cccc3Cl)c3[nH]c(c(CC)c3CC)c2-c2c(Cl)cccc2Cl)C(CC)=C1CC |
| InChI | InChI=1S/C60H54Cl8N4/c1-9-29-30(10-2)54-50(46-39(63)23-18-24-40(46)64)56-33(13-5)34(14-6)58(71-56)52(48-43(67)27-20-28-44(48)68)60-36(16-8)35(15-7)59(72-60)51(47-41(65)25-19-26-42(47)66)57-32(12-4)31(11-3)55(70-57)49(53(29)69-54)45-37(61)21-17-22-38(45)62/h17-28,69,72H,9-16H2,1-8H3/b53-49-,54-50-,55-49-,56-50-,57-51-,58-52-,59-51-,60-52- |
| InChIKey | FYPYPRUOLURIPI-CEFGTSHDSA-N |
| XLogP | 21.92 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.74 |
| LogP ≤ 5 | 21.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |