C50H54N4 — CID 136824566
2,3,7,8,12,13,17,18-octaethyl-5-phenanthren-9-yl-21,23-dihydroporphyrin (PubChem CID 136824566) has the molecular formula C50H54N4 and a molecular weight of 711.01 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethyl-5-phenanthren-9-yl-21,23-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethyl-5-phenanthren-9-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136824566 |
| Molecular Formula | C50H54N4 |
| Molecular Weight | 711.01 g/mol |
| Exact Mass | 710.43 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethyl-5-phenanthren-9-yl-21,23-dihydroporphyrin |
| SMILES | CCC1=C(CC)c2cc3[nH]c(c(CC)c3CC)c(-c3cc4ccccc4c4ccccc34)c3nc(cc4[nH]c(cc1n2)c(CC)c4CC)C(CC)=C3CC |
| InChI | InChI=1S/C50H54N4/c1-9-30-32(11-3)44-27-46-34(13-5)36(15-7)49(53-46)48(41-25-29-21-17-18-22-38(29)39-23-19-20-24-40(39)41)50-37(16-8)35(14-6)47(54-50)28-45-33(12-4)31(10-2)43(52-45)26-42(30)51-44/h17-28,51,54H,9-16H2,1-8H3/b42-26-,43-26-,44-27-,45-28-,46-27-,47-28-,49-48-,50-48- |
| InChIKey | PECMKUNTTISSRM-MUHJXVAWSA-N |
| XLogP | 14.00 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.01 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|