C36H46CuN4+2 — CID 135742550
copper 2,3,7,8,12,13,17,18-octaethyl-21,22-dihydroporphyrin (PubChem CID 135742550) has the molecular formula C36H46CuN4+2 and a molecular weight of 598.34 g/mol. Its IUPAC name is copper 2,3,7,8,12,13,17,18-octaethyl-21,22-dihydroporphyrin.
| Compound Name | copper 2,3,7,8,12,13,17,18-octaethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 135742550 |
| Molecular Formula | C36H46CuN4+2 |
| Molecular Weight | 598.34 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | copper 2,3,7,8,12,13,17,18-octaethyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(CC)c2cc3[nH]c(cc4[nH]c(cc5nc(cc1n2)C(CC)=C5CC)c(CC)c4CC)c(CC)c3CC.[Cu+2] |
| InChI | InChI=1S/C36H46N4.Cu/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20,37-38H,9-16H2,1-8H3;/q;+2/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-; |
| InChIKey | WFSAAHAELIOZOR-XTPDIVBZSA-N |
| XLogP | 10.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.34 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |