C36H48N4 — CID 15886626
(2S,3S)-2,3,7,8,12,13,17,18-octaethyl-2,3,22,24-tetrahydroporphyrin (PubChem CID 15886626) has the molecular formula C36H48N4 and a molecular weight of 536.81 g/mol. Its IUPAC name is (2S,3S)-2,3,7,8,12,13,17,18-octaethyl-2,3,22,24-tetrahydroporphyrin.
| Compound Name | (2S,3S)-2,3,7,8,12,13,17,18-octaethyl-2,3,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 15886626 |
| Molecular Formula | C36H48N4 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | (2S,3S)-2,3,7,8,12,13,17,18-octaethyl-2,3,22,24-tetrahydroporphyrin |
| SMILES | CCC1=C(CC)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(CC)c5CC)[C@@H](CC)[C@@H]4CC)c(CC)c3CC |
| InChI | InChI=1S/C36H48N4/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30/h17-22,38-39H,9-16H2,1-8H3/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20-/t21-,22-/m0/s1 |
| InChIKey | SPQXFTYGDNWOFE-RKFGLQMSSA-N |
| XLogP | 9.98 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |