C33H42N4 — CID 100952744
2,3,8,12,17,18-hexaethyl-7,13-dimethyl-22,23-dihydro-21H-corrin (PubChem CID 100952744) has the molecular formula C33H42N4 and a molecular weight of 494.73 g/mol. Its IUPAC name is 2,3,8,12,17,18-hexaethyl-7,13-dimethyl-22,23-dihydro-21H-corrin.
| Compound Name | 2,3,8,12,17,18-hexaethyl-7,13-dimethyl-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 100952744 |
| Molecular Formula | C33H42N4 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | 2,3,8,12,17,18-hexaethyl-7,13-dimethyl-22,23-dihydro-21H-corrin |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3[nH]c(cc4[nH]c2c(CC)c4CC)c(C)c3CC)c(CC)c1C |
| InChI | InChI=1S/C33H42N4/c1-9-20-18(7)26-15-30-22(11-3)24(13-5)32(36-30)33-25(14-6)23(12-4)31(37-33)16-27-19(8)21(10-2)29(35-27)17-28(20)34-26/h15-17,34-36H,9-14H2,1-8H3/b26-15-,27-16-,28-17-,29-17-,30-15-,31-16-,33-32- |
| InChIKey | PWIULKCRJBZSKF-DELLSYKJSA-N |
| XLogP | 9.12 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |