C33H41N5 — CID 23404528
4,5,10,14,19,20-hexaethyl-9,15-dimethyl-2,21,22,23,24-pentazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16,18(21),19-undecaene (PubChem CID 23404528) has the molecular formula C33H41N5 and a molecular weight of 507.73 g/mol. Its IUPAC name is 4,5,10,14,19,20-hexaethyl-9,15-dimethyl-2,21,22,23,24-pentazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16,18(21),19-undecaene.
| Compound Name | 4,5,10,14,19,20-hexaethyl-9,15-dimethyl-2,21,22,23,24-pentazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 23404528 |
| Molecular Formula | C33H41N5 |
| Molecular Weight | 507.73 g/mol |
| Exact Mass | 507.34 |
| IUPAC Name | 4,5,10,14,19,20-hexaethyl-9,15-dimethyl-2,21,22,23,24-pentazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),4,6,8,10,12,14,16,18(21),19-undecaene |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(n2)C(CC)=C4CC)c(C)c3CC)c(CC)c1C |
| InChI | InChI=1S/C33H41N5/c1-9-20-18(7)26-15-30-22(11-3)24(13-5)32(36-30)38-33-25(14-6)23(12-4)31(37-33)16-27-19(8)21(10-2)29(35-27)17-28(20)34-26/h15-17,34-35H,9-14H2,1-8H3/b26-15-,27-16-,28-17-,29-17-,30-15-,31-16-,38-32-,38-33- |
| InChIKey | IFPBNHOKNCQMCK-XZPNACOFSA-N |
| XLogP | 8.91 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.73 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |