C33H38N4 — CID 10074330
4,9,14-triethyl-5,10,15-trimethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,10,12,14,16(26),17,19(24)-undecaene (PubChem CID 10074330) has the molecular formula C33H38N4 and a molecular weight of 490.70 g/mol. Its IUPAC name is 4,9,14-triethyl-5,10,15-trimethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,10,12,14,16(26),17,19(24)-undecaene.
| Compound Name | 4,9,14-triethyl-5,10,15-trimethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,10,12,14,16(26),17,19(24)-undecaene |
|---|---|
| PubChem CID | 10074330 |
| Molecular Formula | C33H38N4 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 4,9,14-triethyl-5,10,15-trimethyl-25,26,27,28-tetrazahexacyclo[16.6.1.13,6.18,11.113,16.019,24]octacosa-1(25),2,4,6,8,10,12,14,16(26),17,19(24)-undecaene |
| SMILES | CCC1=C(C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5CC)c(C)c4CC)C1=C3CCCC1 |
| InChI | InChI=1S/C33H38N4/c1-7-21-18(4)26-14-30-22(8-2)19(5)28(35-30)16-32-24-12-10-11-13-25(24)33(37-32)17-31-23(9-3)20(6)27(36-31)15-29(21)34-26/h14-17,34,36H,7-13H2,1-6H3/b26-14-,27-15-,28-16-,29-15-,30-14-,31-17-,32-16-,33-17- |
| InChIKey | MXQZERBWEZFUGT-SXWJZWMKSA-N |
| XLogP | 8.88 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |