C40H54N4 — CID 86190122
3,7,12,18-tetrabutyl-2,8,13,17-tetramethyl-21,22-dihydroporphyrin (PubChem CID 86190122) has the molecular formula C40H54N4 and a molecular weight of 590.90 g/mol. Its IUPAC name is 3,7,12,18-tetrabutyl-2,8,13,17-tetramethyl-21,22-dihydroporphyrin.
| Compound Name | 3,7,12,18-tetrabutyl-2,8,13,17-tetramethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 86190122 |
| Molecular Formula | C40H54N4 |
| Molecular Weight | 590.90 g/mol |
| Exact Mass | 590.43 |
| IUPAC Name | 3,7,12,18-tetrabutyl-2,8,13,17-tetramethyl-21,22-dihydroporphyrin |
| SMILES | CCCCC1=C(C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5CCCC)c(CCCC)c4C)C(CCCC)=C3C |
| InChI | InChI=1S/C40H54N4/c1-9-13-17-29-25(5)33-21-34-26(6)30(18-14-10-2)38(42-34)23-36-28(8)32(20-16-12-4)40(44-36)24-39-31(19-15-11-3)27(7)35(43-39)22-37(29)41-33/h21-24,43-44H,9-20H2,1-8H3/b33-21-,34-21-,35-22-,36-23-,37-22-,38-23-,39-24-,40-24- |
| InChIKey | DCUZFGPUTFLQFY-OJKAWOKHSA-N |
| XLogP | 11.86 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.90 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |