C42H49BrN4 — CID 177471691
10-(4-bromophenyl)-3,7,8,12,13,17-hexamethyl-2,18-dipentyl-21,22-dihydroporphyrin (PubChem CID 177471691) has the molecular formula C42H49BrN4 and a molecular weight of 689.79 g/mol. Its IUPAC name is 10-(4-bromophenyl)-3,7,8,12,13,17-hexamethyl-2,18-dipentyl-21,22-dihydroporphyrin.
| Compound Name | 10-(4-bromophenyl)-3,7,8,12,13,17-hexamethyl-2,18-dipentyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 177471691 |
| Molecular Formula | C42H49BrN4 |
| Molecular Weight | 689.79 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 10-(4-bromophenyl)-3,7,8,12,13,17-hexamethyl-2,18-dipentyl-21,22-dihydroporphyrin |
| SMILES | CCCCCC1=C(C)c2cc3nc(c(-c4ccc(Br)cc4)c4[nH]c(cc5[nH]c(cc1n2)c(CCCCC)c5C)c(C)c4C)C(C)=C3C |
| InChI | InChI=1S/C42H49BrN4/c1-9-11-13-15-32-28(7)36-21-34-24(3)26(5)41(46-34)40(30-17-19-31(43)20-18-30)42-27(6)25(4)35(47-42)22-37-29(8)33(16-14-12-10-2)39(45-37)23-38(32)44-36/h17-23,44,46H,9-16H2,1-8H3/b34-21-,35-22-,36-21-,37-22-,38-23-,39-23-,41-40-,42-40- |
| InChIKey | MZPQVHOEXLWQFF-WOHUSFEESA-N |
| XLogP | 12.86 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.79 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|