C48H50N4O2 — CID 177452613
(5aR,11aR)-8-(13,17-diethyl-2,3,7,8,12,18-hexamethyl-21,24-dihydroporphyrin-5-yl)-4a,5,5a,6,11,11a,12,12a-octahydrotetracene-1,4-dione (PubChem CID 177452613) has the molecular formula C48H50N4O2 and a molecular weight of 714.95 g/mol. Its IUPAC name is (5aR,11aR)-8-(13,17-diethyl-2,3,7,8,12,18-hexamethyl-21,24-dihydroporphyrin-5-yl)-4a,5,5a,6,11,11a,12,12a-octahydrotetracene-1,4-dione.
| Compound Name | (5aR,11aR)-8-(13,17-diethyl-2,3,7,8,12,18-hexamethyl-21,24-dihydroporphyrin-5-yl)-4a,5,5a,6,11,11a,12,12a-octahydrotetracene-1,4-dione |
|---|---|
| PubChem CID | 177452613 |
| Molecular Formula | C48H50N4O2 |
| Molecular Weight | 714.95 g/mol |
| Exact Mass | 714.39 |
| IUPAC Name | (5aR,11aR)-8-(13,17-diethyl-2,3,7,8,12,18-hexamethyl-21,24-dihydroporphyrin-5-yl)-4a,5,5a,6,11,11a,12,12a-octahydrotetracene-1,4-dione |
| SMILES | CCC1=C(C)c2cc3nc(c(-c4ccc5c(c4)C[C@H]4CC6C(=O)C=CC(=O)C6C[C@@H]4C5)c4[nH]c(cc5[nH]c(cc1n2)c(CC)c5C)c(C)c4C)C(C)=C3C |
| InChI | InChI=1S/C48H50N4O2/c1-9-34-27(7)40-20-38-23(3)25(5)47(51-38)46(48-26(6)24(4)39(52-48)21-41-28(8)35(10-2)43(50-41)22-42(34)49-40)30-12-11-29-15-32-18-36-37(45(54)14-13-44(36)53)19-33(32)17-31(29)16-30/h11-14,16,20-22,32-33,36-37,49,51H,9-10,15,17-19H2,1-8H3/b38-20-,39-21-,40-20-,41-21-,42-22-,43-22-,47-46-,48-46-/t32-,33-,36?,37?/m0/s1 |
| InChIKey | VDMYMPYVFCJSHU-ZBUAUFQLSA-N |
| XLogP | 10.83 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.95 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |