C39H46N4 — CID 10650716
2,3,7,13,17,18-hexaethyl-8,12-dimethyl-10-phenyl-22,24-dihydro-21H-corrin (PubChem CID 10650716) has the molecular formula C39H46N4 and a molecular weight of 570.83 g/mol. Its IUPAC name is 2,3,7,13,17,18-hexaethyl-8,12-dimethyl-10-phenyl-22,24-dihydro-21H-corrin.
| Compound Name | 2,3,7,13,17,18-hexaethyl-8,12-dimethyl-10-phenyl-22,24-dihydro-21H-corrin |
|---|---|
| PubChem CID | 10650716 |
| Molecular Formula | C39H46N4 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | 2,3,7,13,17,18-hexaethyl-8,12-dimethyl-10-phenyl-22,24-dihydro-21H-corrin |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(c(CC)c1CC)c1[nH]c(cc3[nH]c(c(C)c3CC)c2-c2ccccc2)c(CC)c1CC |
| InChI | InChI=1S/C39H46N4/c1-9-25-22(7)36-35(24-18-16-15-17-19-24)37-23(8)26(10-2)32(41-37)21-34-28(12-4)30(14-6)39(43-34)38-29(13-5)27(11-3)33(42-38)20-31(25)40-36/h15-21,40,42-43H,9-14H2,1-8H3/b31-20-,32-21-,33-20-,34-21-,36-35-,37-35-,39-38- |
| InChIKey | PJNBXGPAJQTPPF-RFRWEUKJSA-N |
| XLogP | 10.65 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |